C18H18FN3S — CID 70677135
3-(4-fluorophenyl)-N-methyl-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 70677135) has the molecular formula C18H18FN3S and a molecular weight of 327.43 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-methyl-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 3-(4-fluorophenyl)-N-methyl-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 70677135 |
| Molecular Formula | C18H18FN3S |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 3-(4-fluorophenyl)-N-methyl-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | CNC(=S)N1N=C(c2ccc(C)cc2)CC1c1ccc(F)cc1 |
| InChI | InChI=1S/C18H18FN3S/c1-12-3-5-13(6-4-12)16-11-17(22(21-16)18(23)20-2)14-7-9-15(19)10-8-14/h3-10,17H,11H2,1-2H3,(H,20,23) |
| InChIKey | SYJJZHKRFNUDPN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|