C22H16BrF2N3S — CID 3944785
5-(4-bromophenyl)-N,3-bis(4-fluorophenyl)-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 3944785) has the molecular formula C22H16BrF2N3S and a molecular weight of 472.36 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N,3-bis(4-fluorophenyl)-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 5-(4-bromophenyl)-N,3-bis(4-fluorophenyl)-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 3944785 |
| Molecular Formula | C22H16BrF2N3S |
| Molecular Weight | 472.36 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | 5-(4-bromophenyl)-N,3-bis(4-fluorophenyl)-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | Fc1ccc(NC(=S)N2N=C(c3ccc(Br)cc3)CC2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H16BrF2N3S/c23-16-5-1-14(2-6-16)20-13-21(15-3-7-17(24)8-4-15)28(27-20)22(29)26-19-11-9-18(25)10-12-19/h1-12,21H,13H2,(H,26,29) |
| InChIKey | TVKFXIAPJNQMPV-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.36 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|