C22H17BrN4O2S — CID 25269929
5-(4-bromophenyl)-N-(4-nitrophenyl)-3-phenyl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 25269929) has the molecular formula C22H17BrN4O2S and a molecular weight of 481.38 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-(4-nitrophenyl)-3-phenyl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 5-(4-bromophenyl)-N-(4-nitrophenyl)-3-phenyl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 25269929 |
| Molecular Formula | C22H17BrN4O2S |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 480.03 |
| IUPAC Name | 5-(4-bromophenyl)-N-(4-nitrophenyl)-3-phenyl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | O=[N+]([O-])c1ccc(NC(=S)N2N=C(c3ccc(Br)cc3)CC2c2ccccc2)cc1 |
| InChI | InChI=1S/C22H17BrN4O2S/c23-17-8-6-15(7-9-17)20-14-21(16-4-2-1-3-5-16)26(25-20)22(30)24-18-10-12-19(13-11-18)27(28)29/h1-13,21H,14H2,(H,24,30) |
| InChIKey | IBXITLRRBKBSBB-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|