C22H18BrN3S — CID 25333821
(3S)-3-(4-bromophenyl)-N,5-diphenyl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 25333821) has the molecular formula C22H18BrN3S and a molecular weight of 436.38 g/mol. Its IUPAC name is (3S)-3-(4-bromophenyl)-N,5-diphenyl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | (3S)-3-(4-bromophenyl)-N,5-diphenyl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 25333821 |
| Molecular Formula | C22H18BrN3S |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | (3S)-3-(4-bromophenyl)-N,5-diphenyl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | S=C(Nc1ccccc1)N1N=C(c2ccccc2)C[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H18BrN3S/c23-18-13-11-17(12-14-18)21-15-20(16-7-3-1-4-8-16)25-26(21)22(27)24-19-9-5-2-6-10-19/h1-14,21H,15H2,(H,24,27)/t21-/m0/s1 |
| InChIKey | AUADLSDKILZVSW-NRFANRHFSA-N |
| XLogP | 6.00 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|