C31H23Cl3N8S — CID 118706126
N-[4,6-bis(4-chloroanilino)-1,3,5-triazin-2-yl]-3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 118706126) has the molecular formula C31H23Cl3N8S and a molecular weight of 646.01 g/mol. Its IUPAC name is N-[4,6-bis(4-chloroanilino)-1,3,5-triazin-2-yl]-3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | N-[4,6-bis(4-chloroanilino)-1,3,5-triazin-2-yl]-3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 118706126 |
| Molecular Formula | C31H23Cl3N8S |
| Molecular Weight | 646.01 g/mol |
| Exact Mass | 644.08 |
| IUPAC Name | N-[4,6-bis(4-chloroanilino)-1,3,5-triazin-2-yl]-3-(4-chlorophenyl)-5-phenyl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | S=C(Nc1nc(Nc2ccc(Cl)cc2)nc(Nc2ccc(Cl)cc2)n1)N1N=C(c2ccccc2)CC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H23Cl3N8S/c32-21-8-6-20(7-9-21)27-18-26(19-4-2-1-3-5-19)41-42(27)31(43)40-30-38-28(35-24-14-10-22(33)11-15-24)37-29(39-30)36-25-16-12-23(34)13-17-25/h1-17,27H,18H2,(H3,35,36,37,38,39,40,43) |
| InChIKey | DIYUNLZTJMHKEF-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 90.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.01 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|