C17H17N3S — CID 14956435
N-methyl-3,5-diphenyl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 14956435) has the molecular formula C17H17N3S and a molecular weight of 295.41 g/mol. Its IUPAC name is N-methyl-3,5-diphenyl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | N-methyl-3,5-diphenyl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 14956435 |
| Molecular Formula | C17H17N3S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | N-methyl-3,5-diphenyl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | CNC(=S)N1N=C(c2ccccc2)CC1c1ccccc1 |
| InChI | InChI=1S/C17H17N3S/c1-18-17(21)20-16(14-10-6-3-7-11-14)12-15(19-20)13-8-4-2-5-9-13/h2-11,16H,12H2,1H3,(H,18,21) |
| InChIKey | CVIDURKACODKPV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|