C17H16BrN3S — CID 97062367
(3S)-3-(3-bromophenyl)-N-methyl-5-phenyl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 97062367) has the molecular formula C17H16BrN3S and a molecular weight of 374.31 g/mol. Its IUPAC name is (3S)-3-(3-bromophenyl)-N-methyl-5-phenyl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | (3S)-3-(3-bromophenyl)-N-methyl-5-phenyl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 97062367 |
| Molecular Formula | C17H16BrN3S |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | (3S)-3-(3-bromophenyl)-N-methyl-5-phenyl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | CNC(=S)N1N=C(c2ccccc2)C[C@H]1c1cccc(Br)c1 |
| InChI | InChI=1S/C17H16BrN3S/c1-19-17(22)21-16(13-8-5-9-14(18)10-13)11-15(20-21)12-6-3-2-4-7-12/h2-10,16H,11H2,1H3,(H,19,22)/t16-/m0/s1 |
| InChIKey | HLVMIWNHGCMGJT-INIZCTEOSA-N |
| XLogP | 4.10 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|