C16H14BrN3S — CID 46246093
3-(3-bromophenyl)-5-phenyl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 46246093) has the molecular formula C16H14BrN3S and a molecular weight of 360.28 g/mol. Its IUPAC name is 3-(3-bromophenyl)-5-phenyl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 3-(3-bromophenyl)-5-phenyl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 46246093 |
| Molecular Formula | C16H14BrN3S |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 3-(3-bromophenyl)-5-phenyl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | NC(=S)N1N=C(c2ccccc2)CC1c1cccc(Br)c1 |
| InChI | InChI=1S/C16H14BrN3S/c17-13-8-4-7-12(9-13)15-10-14(19-20(15)16(18)21)11-5-2-1-3-6-11/h1-9,15H,10H2,(H2,18,21) |
| InChIKey | DNABWOABVMGVRW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|