C18H18BrN3O2S — CID 24854559
5-(4-bromophenyl)-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 24854559) has the molecular formula C18H18BrN3O2S and a molecular weight of 420.33 g/mol. Its IUPAC name is 5-(4-bromophenyl)-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 5-(4-bromophenyl)-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 24854559 |
| Molecular Formula | C18H18BrN3O2S |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | 5-(4-bromophenyl)-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | COc1ccc(C2CC(c3ccc(Br)cc3)=NN2C(N)=S)cc1OC |
| InChI | InChI=1S/C18H18BrN3O2S/c1-23-16-8-5-12(9-17(16)24-2)15-10-14(21-22(15)18(20)25)11-3-6-13(19)7-4-11/h3-9,15H,10H2,1-2H3,(H2,20,25) |
| InChIKey | ROPUDIJAWMYXLH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|