C27H22BrN3O5 — CID 66488716
1-[2-[5-(4-bromophenyl)-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]indole-2,3-dione (PubChem CID 66488716) has the molecular formula C27H22BrN3O5 and a molecular weight of 548.39 g/mol. Its IUPAC name is 1-[2-[5-(4-bromophenyl)-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]indole-2,3-dione.
| Compound Name | 1-[2-[5-(4-bromophenyl)-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]indole-2,3-dione |
|---|---|
| PubChem CID | 66488716 |
| Molecular Formula | C27H22BrN3O5 |
| Molecular Weight | 548.39 g/mol |
| Exact Mass | 547.07 |
| IUPAC Name | 1-[2-[5-(4-bromophenyl)-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]indole-2,3-dione |
| SMILES | COc1ccc(C2CC(c3ccc(Br)cc3)=NN2C(=O)CN2C(=O)C(=O)c3ccccc32)cc1OC |
| InChI | InChI=1S/C27H22BrN3O5/c1-35-23-12-9-17(13-24(23)36-2)22-14-20(16-7-10-18(28)11-8-16)29-31(22)25(32)15-30-21-6-4-3-5-19(21)26(33)27(30)34/h3-13,22H,14-15H2,1-2H3 |
| InChIKey | PIYIFUGLHSLHQU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 88.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|