C25H17Cl2N3O3 — CID 66489035
1-[2-[3,5-bis(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]indole-2,3-dione (PubChem CID 66489035) has the molecular formula C25H17Cl2N3O3 and a molecular weight of 478.34 g/mol. Its IUPAC name is 1-[2-[3,5-bis(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]indole-2,3-dione.
| Compound Name | 1-[2-[3,5-bis(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]indole-2,3-dione |
|---|---|
| PubChem CID | 66489035 |
| Molecular Formula | C25H17Cl2N3O3 |
| Molecular Weight | 478.34 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | 1-[2-[3,5-bis(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(CC(=O)N2N=C(c3ccc(Cl)cc3)CC2c2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C25H17Cl2N3O3/c26-17-9-5-15(6-10-17)20-13-22(16-7-11-18(27)12-8-16)30(28-20)23(31)14-29-21-4-2-1-3-19(21)24(32)25(29)33/h1-12,22H,13-14H2 |
| InChIKey | PUAFGUKQZQWQTK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.34 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|