C27H22ClFN4O3 — CID 66488342
5-chloro-1-[2-[3-[4-(dimethylamino)phenyl]-5-(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]indole-2,3-dione (PubChem CID 66488342) has the molecular formula C27H22ClFN4O3 and a molecular weight of 504.95 g/mol. Its IUPAC name is 5-chloro-1-[2-[3-[4-(dimethylamino)phenyl]-5-(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]indole-2,3-dione.
| Compound Name | 5-chloro-1-[2-[3-[4-(dimethylamino)phenyl]-5-(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]indole-2,3-dione |
|---|---|
| PubChem CID | 66488342 |
| Molecular Formula | C27H22ClFN4O3 |
| Molecular Weight | 504.95 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 5-chloro-1-[2-[3-[4-(dimethylamino)phenyl]-5-(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]indole-2,3-dione |
| SMILES | CN(C)c1ccc(C2CC(c3ccc(F)cc3)=NN2C(=O)CN2C(=O)C(=O)c3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C27H22ClFN4O3/c1-31(2)20-10-5-17(6-11-20)24-14-22(16-3-8-19(29)9-4-16)30-33(24)25(34)15-32-23-12-7-18(28)13-21(23)26(35)27(32)36/h3-13,24H,14-15H2,1-2H3 |
| InChIKey | LYMUOCYEPAKDEF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 73.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.95 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|