C27H18ClN3O3S — CID 66488850
5-chloro-1-[2-(5-naphthalen-2-yl-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl)-2-oxoethyl]indole-2,3-dione (PubChem CID 66488850) has the molecular formula C27H18ClN3O3S and a molecular weight of 499.98 g/mol. Its IUPAC name is 5-chloro-1-[2-(5-naphthalen-2-yl-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl)-2-oxoethyl]indole-2,3-dione.
| Compound Name | 5-chloro-1-[2-(5-naphthalen-2-yl-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl)-2-oxoethyl]indole-2,3-dione |
|---|---|
| PubChem CID | 66488850 |
| Molecular Formula | C27H18ClN3O3S |
| Molecular Weight | 499.98 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | 5-chloro-1-[2-(5-naphthalen-2-yl-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl)-2-oxoethyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(CC(=O)N2N=C(c3ccc4ccccc4c3)CC2c2cccs2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C27H18ClN3O3S/c28-19-9-10-22-20(13-19)26(33)27(34)30(22)15-25(32)31-23(24-6-3-11-35-24)14-21(29-31)18-8-7-16-4-1-2-5-17(16)12-18/h1-13,23H,14-15H2 |
| InChIKey | UKOWGILKZNJTGG-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.98 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|