C18H15BrN4O3S — CID 66488861
3-[2-[5-(4-bromophenyl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 66488861) has the molecular formula C18H15BrN4O3S and a molecular weight of 447.31 g/mol. Its IUPAC name is 3-[2-[5-(4-bromophenyl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-[5-(4-bromophenyl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 66488861 |
| Molecular Formula | C18H15BrN4O3S |
| Molecular Weight | 447.31 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | 3-[2-[5-(4-bromophenyl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1CC(=O)N1N=C(c2ccc(Br)cc2)CC1c1cccs1 |
| InChI | InChI=1S/C18H15BrN4O3S/c19-12-5-3-11(4-6-12)13-8-14(15-2-1-7-27-15)23(21-13)17(25)10-22-16(24)9-20-18(22)26/h1-7,14H,8-10H2,(H,20,26) |
| InChIKey | KSXJZVDRQBHMKY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|