C18H16N4O4S2 — CID 40881867
1-[2-[(3R)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3-ethylimidazolidine-2,4,5-trione (PubChem CID 40881867) has the molecular formula C18H16N4O4S2 and a molecular weight of 416.48 g/mol. Its IUPAC name is 1-[2-[(3R)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3-ethylimidazolidine-2,4,5-trione.
| Compound Name | 1-[2-[(3R)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3-ethylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 40881867 |
| Molecular Formula | C18H16N4O4S2 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 1-[2-[(3R)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-3-ethylimidazolidine-2,4,5-trione |
| SMILES | CCN1C(=O)C(=O)N(CC(=O)N2N=C(c3cccs3)C[C@@H]2c2cccs2)C1=O |
| InChI | InChI=1S/C18H16N4O4S2/c1-2-20-16(24)17(25)21(18(20)26)10-15(23)22-12(14-6-4-8-28-14)9-11(19-22)13-5-3-7-27-13/h3-8,12H,2,9-10H2,1H3/t12-/m1/s1 |
| InChIKey | YYTXUODWDCUSFG-GFCCVEGCSA-N |
| XLogP | 2.30 |
| TPSA | 90.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|