C23H17N3O5S2 — CID 42984029
[2-(3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 42984029) has the molecular formula C23H17N3O5S2 and a molecular weight of 479.54 g/mol. Its IUPAC name is [2-(3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [2-(3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 42984029 |
| Molecular Formula | C23H17N3O5S2 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | [2-(3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)OCC(=O)N1N=C(c2cccs2)CC1c1cccs1 |
| InChI | InChI=1S/C23H17N3O5S2/c27-20(13-31-21(28)12-25-22(29)14-5-1-2-6-15(14)23(25)30)26-17(19-8-4-10-33-19)11-16(24-26)18-7-3-9-32-18/h1-10,17H,11-13H2 |
| InChIKey | YGMFWAAUGIFHKG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 96.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|