C19H18N3OS2+ — CID 8827500
1-[(3S)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-(4-methylpyridin-1-ium-1-yl)ethanone (PubChem CID 8827500) has the molecular formula C19H18N3OS2+ and a molecular weight of 368.51 g/mol. Its IUPAC name is 1-[(3S)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-(4-methylpyridin-1-ium-1-yl)ethanone.
| Compound Name | 1-[(3S)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-(4-methylpyridin-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 8827500 |
| Molecular Formula | C19H18N3OS2+ |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 1-[(3S)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-(4-methylpyridin-1-ium-1-yl)ethanone |
| SMILES | Cc1cc[n+](CC(=O)N2N=C(c3cccs3)C[C@H]2c2cccs2)cc1 |
| InChI | InChI=1S/C19H18N3OS2/c1-14-6-8-21(9-7-14)13-19(23)22-16(18-5-3-11-25-18)12-15(20-22)17-4-2-10-24-17/h2-11,16H,12-13H2,1H3/q+1/t16-/m0/s1 |
| InChIKey | UTZZQLBAZXXEPJ-INIZCTEOSA-N |
| XLogP | 3.78 |
| TPSA | 36.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|