C20H18N3O2S2+ — CID 8831092
2-(3-acetylpyridin-1-ium-1-yl)-1-[(3R)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]ethanone (PubChem CID 8831092) has the molecular formula C20H18N3O2S2+ and a molecular weight of 396.52 g/mol. Its IUPAC name is 2-(3-acetylpyridin-1-ium-1-yl)-1-[(3R)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]ethanone.
| Compound Name | 2-(3-acetylpyridin-1-ium-1-yl)-1-[(3R)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 8831092 |
| Molecular Formula | C20H18N3O2S2+ |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 2-(3-acetylpyridin-1-ium-1-yl)-1-[(3R)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]ethanone |
| SMILES | CC(=O)c1ccc[n+](CC(=O)N2N=C(c3cccs3)C[C@@H]2c2cccs2)c1 |
| InChI | InChI=1S/C20H18N3O2S2/c1-14(24)15-5-2-8-22(12-15)13-20(25)23-17(19-7-4-10-27-19)11-16(21-23)18-6-3-9-26-18/h2-10,12,17H,11,13H2,1H3/q+1/t17-/m1/s1 |
| InChIKey | HVMCFOQUEVUFHS-QGZVFWFLSA-N |
| XLogP | 3.68 |
| TPSA | 53.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|