C20H20N3OS2+ — CID 8828281
2-(2,3-dimethylpyridin-1-ium-1-yl)-1-[(3R)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]ethanone (PubChem CID 8828281) has the molecular formula C20H20N3OS2+ and a molecular weight of 382.53 g/mol. Its IUPAC name is 2-(2,3-dimethylpyridin-1-ium-1-yl)-1-[(3R)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]ethanone.
| Compound Name | 2-(2,3-dimethylpyridin-1-ium-1-yl)-1-[(3R)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 8828281 |
| Molecular Formula | C20H20N3OS2+ |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 2-(2,3-dimethylpyridin-1-ium-1-yl)-1-[(3R)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]ethanone |
| SMILES | Cc1ccc[n+](CC(=O)N2N=C(c3cccs3)C[C@@H]2c2cccs2)c1C |
| InChI | InChI=1S/C20H20N3OS2/c1-14-6-3-9-22(15(14)2)13-20(24)23-17(19-8-5-11-26-19)12-16(21-23)18-7-4-10-25-18/h3-11,17H,12-13H2,1-2H3/q+1/t17-/m1/s1 |
| InChIKey | KIEUSKRSUBJVNA-QGZVFWFLSA-N |
| XLogP | 4.09 |
| TPSA | 36.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|