C18H18N4O3S2 — CID 41117291
3-[2-[(3S)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 41117291) has the molecular formula C18H18N4O3S2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 3-[2-[(3S)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[2-[(3S)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 41117291 |
| Molecular Formula | C18H18N4O3S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 3-[2-[(3S)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CC(=O)N2N=C(c3cccs3)C[C@H]2c2cccs2)C1=O |
| InChI | InChI=1S/C18H18N4O3S2/c1-18(2)16(24)21(17(25)19-18)10-15(23)22-12(14-6-4-8-27-14)9-11(20-22)13-5-3-7-26-13/h3-8,12H,9-10H2,1-2H3,(H,19,25)/t12-/m0/s1 |
| InChIKey | HDIPYJJPWJFSLZ-LBPRGKRZSA-N |
| XLogP | 2.82 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|