C24H20N4O4S2 — CID 25362814
(4R)-3'-[2-[(3S)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 25362814) has the molecular formula C24H20N4O4S2 and a molecular weight of 492.58 g/mol. Its IUPAC name is (4R)-3'-[2-[(3S)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | (4R)-3'-[2-[(3S)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 25362814 |
| Molecular Formula | C24H20N4O4S2 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | (4R)-3'-[2-[(3S)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1N[C@@]2(CCOc3ccccc32)C(=O)N1CC(=O)N1N=C(c2cccs2)C[C@H]1c1cccs1 |
| InChI | InChI=1S/C24H20N4O4S2/c29-21(28-17(20-8-4-12-34-20)13-16(26-28)19-7-3-11-33-19)14-27-22(30)24(25-23(27)31)9-10-32-18-6-2-1-5-15(18)24/h1-8,11-12,17H,9-10,13-14H2,(H,25,31)/t17-,24+/m0/s1 |
| InChIKey | KMCHVPJTWVVMLP-BXKMTCNYSA-N |
| XLogP | 3.72 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|