C31H25N3O5 — CID 66488561
1-[2-[3-(3,4-dimethoxyphenyl)-5-naphthalen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]indole-2,3-dione (PubChem CID 66488561) has the molecular formula C31H25N3O5 and a molecular weight of 519.56 g/mol. Its IUPAC name is 1-[2-[3-(3,4-dimethoxyphenyl)-5-naphthalen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]indole-2,3-dione.
| Compound Name | 1-[2-[3-(3,4-dimethoxyphenyl)-5-naphthalen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]indole-2,3-dione |
|---|---|
| PubChem CID | 66488561 |
| Molecular Formula | C31H25N3O5 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | 1-[2-[3-(3,4-dimethoxyphenyl)-5-naphthalen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]indole-2,3-dione |
| SMILES | COc1ccc(C2CC(c3ccc4ccccc4c3)=NN2C(=O)CN2C(=O)C(=O)c3ccccc32)cc1OC |
| InChI | InChI=1S/C31H25N3O5/c1-38-27-14-13-22(16-28(27)39-2)26-17-24(21-12-11-19-7-3-4-8-20(19)15-21)32-34(26)29(35)18-33-25-10-6-5-9-23(25)30(36)31(33)37/h3-16,26H,17-18H2,1-2H3 |
| InChIKey | SJZJRMGAOMUTMY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 88.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|