C20H21ClN2O4 — CID 66488625
2-chloro-1-[3-(3,4-dimethoxyphenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone (PubChem CID 66488625) has the molecular formula C20H21ClN2O4 and a molecular weight of 388.85 g/mol. Its IUPAC name is 2-chloro-1-[3-(3,4-dimethoxyphenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone.
| Compound Name | 2-chloro-1-[3-(3,4-dimethoxyphenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 66488625 |
| Molecular Formula | C20H21ClN2O4 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 2-chloro-1-[3-(3,4-dimethoxyphenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone |
| SMILES | COc1ccc(C2=NN(C(=O)CCl)C(c3ccc(OC)c(OC)c3)C2)cc1 |
| InChI | InChI=1S/C20H21ClN2O4/c1-25-15-7-4-13(5-8-15)16-11-17(23(22-16)20(24)12-21)14-6-9-18(26-2)19(10-14)27-3/h4-10,17H,11-12H2,1-3H3 |
| InChIKey | GAXHPRCAIABGPW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|