C21H19N3S — CID 71524965
5-(4-methylphenyl)-3-naphthalen-2-yl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 71524965) has the molecular formula C21H19N3S and a molecular weight of 345.47 g/mol. Its IUPAC name is 5-(4-methylphenyl)-3-naphthalen-2-yl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 5-(4-methylphenyl)-3-naphthalen-2-yl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 71524965 |
| Molecular Formula | C21H19N3S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 5-(4-methylphenyl)-3-naphthalen-2-yl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | Cc1ccc(C2=NN(C(N)=S)C(c3ccc4ccccc4c3)C2)cc1 |
| InChI | InChI=1S/C21H19N3S/c1-14-6-8-16(9-7-14)19-13-20(24(23-19)21(22)25)18-11-10-15-4-2-3-5-17(15)12-18/h2-12,20H,13H2,1H3,(H2,22,25) |
| InChIKey | QAEQSYBSVNAKON-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|