C16H17N3S — CID 139230668
3-cyclopenta-1,3-dien-1-yl-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 139230668) has the molecular formula C16H17N3S and a molecular weight of 283.40 g/mol. Its IUPAC name is 3-cyclopenta-1,3-dien-1-yl-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 3-cyclopenta-1,3-dien-1-yl-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 139230668 |
| Molecular Formula | C16H17N3S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 3-cyclopenta-1,3-dien-1-yl-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | Cc1ccc(C2=NN(C(N)=S)C(C3=CC=CC3)C2)cc1 |
| InChI | InChI=1S/C16H17N3S/c1-11-6-8-12(9-7-11)14-10-15(13-4-2-3-5-13)19(18-14)16(17)20/h2-4,6-9,15H,5,10H2,1H3,(H2,17,20) |
| InChIKey | AEZYJXDDPYEQBV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|