C18H18BrN3S — CID 46842882
3-(4-bromophenyl)-5-(3,4-dimethylphenyl)-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 46842882) has the molecular formula C18H18BrN3S and a molecular weight of 388.33 g/mol. Its IUPAC name is 3-(4-bromophenyl)-5-(3,4-dimethylphenyl)-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 3-(4-bromophenyl)-5-(3,4-dimethylphenyl)-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 46842882 |
| Molecular Formula | C18H18BrN3S |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 3-(4-bromophenyl)-5-(3,4-dimethylphenyl)-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | Cc1ccc(C2=NN(C(N)=S)C(c3ccc(Br)cc3)C2)cc1C |
| InChI | InChI=1S/C18H18BrN3S/c1-11-3-4-14(9-12(11)2)16-10-17(22(21-16)18(20)23)13-5-7-15(19)8-6-13/h3-9,17H,10H2,1-2H3,(H2,20,23) |
| InChIKey | NGVQHAXJXAYXSR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|