C28H21Cl2N3O2 — CID 134111213
3,5-bis(4-chlorophenyl)-N-(3-phenoxyphenyl)-3,4-dihydropyrazole-2-carboxamide (PubChem CID 134111213) has the molecular formula C28H21Cl2N3O2 and a molecular weight of 502.40 g/mol. Its IUPAC name is 3,5-bis(4-chlorophenyl)-N-(3-phenoxyphenyl)-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | 3,5-bis(4-chlorophenyl)-N-(3-phenoxyphenyl)-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 134111213 |
| Molecular Formula | C28H21Cl2N3O2 |
| Molecular Weight | 502.40 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | 3,5-bis(4-chlorophenyl)-N-(3-phenoxyphenyl)-3,4-dihydropyrazole-2-carboxamide |
| SMILES | O=C(Nc1cccc(Oc2ccccc2)c1)N1N=C(c2ccc(Cl)cc2)CC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H21Cl2N3O2/c29-21-13-9-19(10-14-21)26-18-27(20-11-15-22(30)16-12-20)33(32-26)28(34)31-23-5-4-8-25(17-23)35-24-6-2-1-3-7-24/h1-17,27H,18H2,(H,31,34) |
| InChIKey | RPRYQOVPRYHTGX-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.40 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |