C19H18FN3S — CID 70677294
3-(4-fluorophenyl)-5-phenyl-N-prop-2-enyl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 70677294) has the molecular formula C19H18FN3S and a molecular weight of 339.44 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-phenyl-N-prop-2-enyl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 3-(4-fluorophenyl)-5-phenyl-N-prop-2-enyl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 70677294 |
| Molecular Formula | C19H18FN3S |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 3-(4-fluorophenyl)-5-phenyl-N-prop-2-enyl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | C=CCNC(=S)N1N=C(c2ccccc2)CC1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H18FN3S/c1-2-12-21-19(24)23-18(15-8-10-16(20)11-9-15)13-17(22-23)14-6-4-3-5-7-14/h2-11,18H,1,12-13H2,(H,21,24) |
| InChIKey | NENULRCWGHEQNX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|