C15H15N3S3 — CID 25158089
N-prop-2-enyl-3,5-dithiophen-2-yl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 25158089) has the molecular formula C15H15N3S3 and a molecular weight of 333.51 g/mol. Its IUPAC name is N-prop-2-enyl-3,5-dithiophen-2-yl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | N-prop-2-enyl-3,5-dithiophen-2-yl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 25158089 |
| Molecular Formula | C15H15N3S3 |
| Molecular Weight | 333.51 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | N-prop-2-enyl-3,5-dithiophen-2-yl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | C=CCNC(=S)N1N=C(c2cccs2)CC1c1cccs1 |
| InChI | InChI=1S/C15H15N3S3/c1-2-7-16-15(19)18-12(14-6-4-9-21-14)10-11(17-18)13-5-3-8-20-13/h2-6,8-9,12H,1,7,10H2,(H,16,19) |
| InChIKey | AKTJQTBLWYONRN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|