C23H22N2O4S2 — CID 71408472
3,5-bis(4-methylsulfonylphenyl)-2-phenyl-3,4-dihydropyrazole (PubChem CID 71408472) has the molecular formula C23H22N2O4S2 and a molecular weight of 454.57 g/mol. Its IUPAC name is 3,5-bis(4-methylsulfonylphenyl)-2-phenyl-3,4-dihydropyrazole.
| Compound Name | 3,5-bis(4-methylsulfonylphenyl)-2-phenyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 71408472 |
| Molecular Formula | C23H22N2O4S2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 3,5-bis(4-methylsulfonylphenyl)-2-phenyl-3,4-dihydropyrazole |
| SMILES | CS(=O)(=O)c1ccc(C2=NN(c3ccccc3)C(c3ccc(S(C)(=O)=O)cc3)C2)cc1 |
| InChI | InChI=1S/C23H22N2O4S2/c1-30(26,27)20-12-8-17(9-13-20)22-16-23(25(24-22)19-6-4-3-5-7-19)18-10-14-21(15-11-18)31(2,28)29/h3-15,23H,16H2,1-2H3 |
| InChIKey | XERCBHUEMOSQEP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 83.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |