C20H19FN6S — CID 139083922
(3R)-3-(4-fluorophenyl)-5-[5-methyl-1-(4-methylphenyl)triazol-4-yl]-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 139083922) has the molecular formula C20H19FN6S and a molecular weight of 394.48 g/mol. Its IUPAC name is (3R)-3-(4-fluorophenyl)-5-[5-methyl-1-(4-methylphenyl)triazol-4-yl]-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | (3R)-3-(4-fluorophenyl)-5-[5-methyl-1-(4-methylphenyl)triazol-4-yl]-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 139083922 |
| Molecular Formula | C20H19FN6S |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | (3R)-3-(4-fluorophenyl)-5-[5-methyl-1-(4-methylphenyl)triazol-4-yl]-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | Cc1ccc(-n2nnc(C3=NN(C(N)=S)[C@@H](c4ccc(F)cc4)C3)c2C)cc1 |
| InChI | InChI=1S/C20H19FN6S/c1-12-3-9-16(10-4-12)26-13(2)19(23-25-26)17-11-18(27(24-17)20(22)28)14-5-7-15(21)8-6-14/h3-10,18H,11H2,1-2H3,(H2,22,28)/t18-/m1/s1 |
| InChIKey | PQLAVJONIBEBSM-GOSISDBHSA-N |
| XLogP | 3.42 |
| TPSA | 72.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|