C20H21N3OS3 — CID 92965992
[2-oxo-2-[(3R)-3-phenyl-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]ethyl] pyrrolidine-1-carbodithioate (PubChem CID 92965992) has the molecular formula C20H21N3OS3 and a molecular weight of 415.61 g/mol. Its IUPAC name is [2-oxo-2-[(3R)-3-phenyl-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]ethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-oxo-2-[(3R)-3-phenyl-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]ethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 92965992 |
| Molecular Formula | C20H21N3OS3 |
| Molecular Weight | 415.61 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | [2-oxo-2-[(3R)-3-phenyl-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]ethyl] pyrrolidine-1-carbodithioate |
| SMILES | O=C(CSC(=S)N1CCCC1)N1N=C(c2cccs2)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H21N3OS3/c24-19(14-27-20(25)22-10-4-5-11-22)23-17(15-7-2-1-3-8-15)13-16(21-23)18-9-6-12-26-18/h1-3,6-9,12,17H,4-5,10-11,13-14H2/t17-/m1/s1 |
| InChIKey | SFUIEHCWFYMPPB-QGZVFWFLSA-N |
| XLogP | 4.54 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|