C20H20FN3O2S3 — CID 94036555
[2-[(3S)-3-(4-fluorophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl] morpholine-4-carbodithioate (PubChem CID 94036555) has the molecular formula C20H20FN3O2S3 and a molecular weight of 449.60 g/mol. Its IUPAC name is [2-[(3S)-3-(4-fluorophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl] morpholine-4-carbodithioate.
| Compound Name | [2-[(3S)-3-(4-fluorophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl] morpholine-4-carbodithioate |
|---|---|
| PubChem CID | 94036555 |
| Molecular Formula | C20H20FN3O2S3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | [2-[(3S)-3-(4-fluorophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl] morpholine-4-carbodithioate |
| SMILES | O=C(CSC(=S)N1CCOCC1)N1N=C(c2cccs2)C[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H20FN3O2S3/c21-15-5-3-14(4-6-15)17-12-16(18-2-1-11-28-18)22-24(17)19(25)13-29-20(27)23-7-9-26-10-8-23/h1-6,11,17H,7-10,12-13H2/t17-/m0/s1 |
| InChIKey | JUICZQJITVKXJM-KRWDZBQOSA-N |
| XLogP | 3.92 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|