C22H25N3O2S3 — CID 5270937
[2-[3-(4-methoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl] piperidine-1-carbodithioate (PubChem CID 5270937) has the molecular formula C22H25N3O2S3 and a molecular weight of 459.66 g/mol. Its IUPAC name is [2-[3-(4-methoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl] piperidine-1-carbodithioate.
| Compound Name | [2-[3-(4-methoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl] piperidine-1-carbodithioate |
|---|---|
| PubChem CID | 5270937 |
| Molecular Formula | C22H25N3O2S3 |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | [2-[3-(4-methoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl] piperidine-1-carbodithioate |
| SMILES | COc1ccc(C2CC(c3cccs3)=NN2C(=O)CSC(=S)N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H25N3O2S3/c1-27-17-9-7-16(8-10-17)19-14-18(20-6-5-13-29-20)23-25(19)21(26)15-30-22(28)24-11-3-2-4-12-24/h5-10,13,19H,2-4,11-12,14-15H2,1H3 |
| InChIKey | KLGOINJHXXZLGI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|