C23H22ClN3O3 — CID 71844184
1-[3-(2-chloro-6-methylquinolin-3-yl)-5-(2,4-dimethoxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone (PubChem CID 71844184) has the molecular formula C23H22ClN3O3 and a molecular weight of 423.90 g/mol. Its IUPAC name is 1-[3-(2-chloro-6-methylquinolin-3-yl)-5-(2,4-dimethoxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone.
| Compound Name | 1-[3-(2-chloro-6-methylquinolin-3-yl)-5-(2,4-dimethoxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 71844184 |
| Molecular Formula | C23H22ClN3O3 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 1-[3-(2-chloro-6-methylquinolin-3-yl)-5-(2,4-dimethoxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone |
| SMILES | COc1ccc(C2=NN(C(C)=O)C(c3cc4cc(C)ccc4nc3Cl)C2)c(OC)c1 |
| InChI | InChI=1S/C23H22ClN3O3/c1-13-5-8-19-15(9-13)10-18(23(24)25-19)21-12-20(26-27(21)14(2)28)17-7-6-16(29-3)11-22(17)30-4/h5-11,21H,12H2,1-4H3 |
| InChIKey | MYCDWCLXTABIOV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|