C21H20ClN3O3S — CID 23800421
2-chloro-3-[5-(4-methoxyphenyl)-2-methylsulfonyl-3,4-dihydropyrazol-3-yl]-6-methylquinoline (PubChem CID 23800421) has the molecular formula C21H20ClN3O3S and a molecular weight of 429.93 g/mol. Its IUPAC name is 2-chloro-3-[5-(4-methoxyphenyl)-2-methylsulfonyl-3,4-dihydropyrazol-3-yl]-6-methylquinoline.
| Compound Name | 2-chloro-3-[5-(4-methoxyphenyl)-2-methylsulfonyl-3,4-dihydropyrazol-3-yl]-6-methylquinoline |
|---|---|
| PubChem CID | 23800421 |
| Molecular Formula | C21H20ClN3O3S |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 2-chloro-3-[5-(4-methoxyphenyl)-2-methylsulfonyl-3,4-dihydropyrazol-3-yl]-6-methylquinoline |
| SMILES | COc1ccc(C2=NN(S(C)(=O)=O)C(c3cc4cc(C)ccc4nc3Cl)C2)cc1 |
| InChI | InChI=1S/C21H20ClN3O3S/c1-13-4-9-18-15(10-13)11-17(21(22)23-18)20-12-19(24-25(20)29(3,26)27)14-5-7-16(28-2)8-6-14/h4-11,20H,12H2,1-3H3 |
| InChIKey | BGOJLXVVCCGOAY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 71.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|