C25H20ClN3O2S — CID 51967938
3-[(3R)-2-(benzenesulfonyl)-5-(4-methylphenyl)-3,4-dihydropyrazol-3-yl]-2-chloroquinoline (PubChem CID 51967938) has the molecular formula C25H20ClN3O2S and a molecular weight of 461.97 g/mol. Its IUPAC name is 3-[(3R)-2-(benzenesulfonyl)-5-(4-methylphenyl)-3,4-dihydropyrazol-3-yl]-2-chloroquinoline.
| Compound Name | 3-[(3R)-2-(benzenesulfonyl)-5-(4-methylphenyl)-3,4-dihydropyrazol-3-yl]-2-chloroquinoline |
|---|---|
| PubChem CID | 51967938 |
| Molecular Formula | C25H20ClN3O2S |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 3-[(3R)-2-(benzenesulfonyl)-5-(4-methylphenyl)-3,4-dihydropyrazol-3-yl]-2-chloroquinoline |
| SMILES | Cc1ccc(C2=NN(S(=O)(=O)c3ccccc3)[C@@H](c3cc4ccccc4nc3Cl)C2)cc1 |
| InChI | InChI=1S/C25H20ClN3O2S/c1-17-11-13-18(14-12-17)23-16-24(21-15-19-7-5-6-10-22(19)27-25(21)26)29(28-23)32(30,31)20-8-3-2-4-9-20/h2-15,24H,16H2,1H3/t24-/m1/s1 |
| InChIKey | ZKSUUGZHOJJSQT-XMMPIXPASA-N |
| XLogP | 5.74 |
| TPSA | 62.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|