C22H22ClN3O4S — CID 41094763
2-chloro-6-ethoxy-3-[(3R)-5-(3-methoxyphenyl)-2-methylsulfonyl-3,4-dihydropyrazol-3-yl]quinoline (PubChem CID 41094763) has the molecular formula C22H22ClN3O4S and a molecular weight of 459.96 g/mol. Its IUPAC name is 2-chloro-6-ethoxy-3-[(3R)-5-(3-methoxyphenyl)-2-methylsulfonyl-3,4-dihydropyrazol-3-yl]quinoline.
| Compound Name | 2-chloro-6-ethoxy-3-[(3R)-5-(3-methoxyphenyl)-2-methylsulfonyl-3,4-dihydropyrazol-3-yl]quinoline |
|---|---|
| PubChem CID | 41094763 |
| Molecular Formula | C22H22ClN3O4S |
| Molecular Weight | 459.96 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 2-chloro-6-ethoxy-3-[(3R)-5-(3-methoxyphenyl)-2-methylsulfonyl-3,4-dihydropyrazol-3-yl]quinoline |
| SMILES | CCOc1ccc2nc(Cl)c([C@H]3CC(c4cccc(OC)c4)=NN3S(C)(=O)=O)cc2c1 |
| InChI | InChI=1S/C22H22ClN3O4S/c1-4-30-17-8-9-19-15(11-17)12-18(22(23)24-19)21-13-20(25-26(21)31(3,27)28)14-6-5-7-16(10-14)29-2/h5-12,21H,4,13H2,1-3H3/t21-/m1/s1 |
| InChIKey | ZQNAYSIWINSUSB-OAQYLSRUSA-N |
| XLogP | 4.41 |
| TPSA | 81.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.96 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|