C18H20N2O4S — CID 122155650
3,5-bis(3-methoxyphenyl)-2-methylsulfonyl-3,4-dihydropyrazole (PubChem CID 122155650) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 3,5-bis(3-methoxyphenyl)-2-methylsulfonyl-3,4-dihydropyrazole.
| Compound Name | 3,5-bis(3-methoxyphenyl)-2-methylsulfonyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 122155650 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 3,5-bis(3-methoxyphenyl)-2-methylsulfonyl-3,4-dihydropyrazole |
| SMILES | COc1cccc(C2=NN(S(C)(=O)=O)C(c3cccc(OC)c3)C2)c1 |
| InChI | InChI=1S/C18H20N2O4S/c1-23-15-8-4-6-13(10-15)17-12-18(20(19-17)25(3,21)22)14-7-5-9-16(11-14)24-2/h4-11,18H,12H2,1-3H3 |
| InChIKey | PPTJPGSSBFHTFA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |