About 2-methylsulfonyl-3,5-diphenyl-3,4-dihydropyrazole
2-methylsulfonyl-3,5-diphenyl-3,4-dihydropyrazole (PubChem CID 2953116) has the molecular formula C16H16N2O2S
and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-methylsulfonyl-3,5-diphenyl-3,4-dihydropyrazole.
Molecular Properties
| Compound Name | 2-methylsulfonyl-3,5-diphenyl-3,4-dihydropyrazole |
| PubChem CID | 2953116 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-methylsulfonyl-3,5-diphenyl-3,4-dihydropyrazole |
| SMILES | CS(=O)(=O)N1N=C(c2ccccc2)CC1c1ccccc1 |
| InChI | InChI=1S/C16H16N2O2S/c1-21(19,20)18-16(14-10-6-3-7-11-14)12-15(17-18)13-8-4-2-5-9-13/h2-11,16H,12H2,1H3 |
| InChIKey | SXOLSQSTIFDBPZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylsulfonyl-3,5-diphenyl-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfonyl-3,5-diphenyl-3,4-dihydropyrazole?
The IUPAC name of 2-methylsulfonyl-3,5-diphenyl-3,4-dihydropyrazole (CID 2953116) is 2-methylsulfonyl-3,5-diphenyl-3,4-dihydropyrazole.
What is the SMILES notation for 2-methylsulfonyl-3,5-diphenyl-3,4-dihydropyrazole?
The canonical SMILES for 2-methylsulfonyl-3,5-diphenyl-3,4-dihydropyrazole is CS(=O)(=O)N1N=C(c2ccccc2)CC1c1ccccc1.
What is the InChIKey of 2-methylsulfonyl-3,5-diphenyl-3,4-dihydropyrazole?
The InChIKey is SXOLSQSTIFDBPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2S/c1-21(19,20)18-16(14-10-6-3-7-11-14)12-15(17-18)13-8-4-2-5-9-13/h2-11,16H,12H2,1H3.
What are the key properties of 2-methylsulfonyl-3,5-diphenyl-3,4-dihydropyrazole?
2-methylsulfonyl-3,5-diphenyl-3,4-dihydropyrazole has a molecular weight of 300.38 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfonyl-3,5-diphenyl-3,4-dihydropyrazole is sourced from PubChem (CID 2953116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).