C16H16N2O2S — CID 2953116
2-methylsulfonyl-3,5-diphenyl-3,4-dihydropyrazole (PubChem CID 2953116) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-methylsulfonyl-3,5-diphenyl-3,4-dihydropyrazole.
| Compound Name | 2-methylsulfonyl-3,5-diphenyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 2953116 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-methylsulfonyl-3,5-diphenyl-3,4-dihydropyrazole |
| SMILES | CS(=O)(=O)N1N=C(c2ccccc2)CC1c1ccccc1 |
| InChI | InChI=1S/C16H16N2O2S/c1-21(19,20)18-16(14-10-6-3-7-11-14)12-15(17-18)13-8-4-2-5-9-13/h2-11,16H,12H2,1H3 |
| InChIKey | SXOLSQSTIFDBPZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |