C16H15N3O4S — CID 124741976
(3R)-2-methylsulfonyl-5-(2-nitrophenyl)-3-phenyl-3,4-dihydropyrazole (PubChem CID 124741976) has the molecular formula C16H15N3O4S and a molecular weight of 345.38 g/mol. Its IUPAC name is (3R)-2-methylsulfonyl-5-(2-nitrophenyl)-3-phenyl-3,4-dihydropyrazole.
| Compound Name | (3R)-2-methylsulfonyl-5-(2-nitrophenyl)-3-phenyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 124741976 |
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | (3R)-2-methylsulfonyl-5-(2-nitrophenyl)-3-phenyl-3,4-dihydropyrazole |
| SMILES | CS(=O)(=O)N1N=C(c2ccccc2[N+](=O)[O-])C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H15N3O4S/c1-24(22,23)18-16(12-7-3-2-4-8-12)11-14(17-18)13-9-5-6-10-15(13)19(20)21/h2-10,16H,11H2,1H3/t16-/m1/s1 |
| InChIKey | XBIOSFFTBSFRLN-MRXNPFEDSA-N |
| XLogP | 2.71 |
| TPSA | 92.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|