C21H18N2O4S — CID 135971401
2-[2-(benzenesulfonyl)-3-(4-hydroxyphenyl)-3,4-dihydropyrazol-5-yl]phenol (PubChem CID 135971401) has the molecular formula C21H18N2O4S and a molecular weight of 394.45 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)-3-(4-hydroxyphenyl)-3,4-dihydropyrazol-5-yl]phenol.
| Compound Name | 2-[2-(benzenesulfonyl)-3-(4-hydroxyphenyl)-3,4-dihydropyrazol-5-yl]phenol |
|---|---|
| PubChem CID | 135971401 |
| Molecular Formula | C21H18N2O4S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 2-[2-(benzenesulfonyl)-3-(4-hydroxyphenyl)-3,4-dihydropyrazol-5-yl]phenol |
| SMILES | O=S(=O)(c1ccccc1)N1N=C(c2ccccc2O)CC1c1ccc(O)cc1 |
| InChI | InChI=1S/C21H18N2O4S/c24-16-12-10-15(11-13-16)20-14-19(18-8-4-5-9-21(18)25)22-23(20)28(26,27)17-6-2-1-3-7-17/h1-13,20,24-25H,14H2 |
| InChIKey | OCMIHTWLNUIYFA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|