C21H18N2O — CID 135772224
2-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]phenol (PubChem CID 135772224) has the molecular formula C21H18N2O and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]phenol.
| Compound Name | 2-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]phenol |
|---|---|
| PubChem CID | 135772224 |
| Molecular Formula | C21H18N2O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]phenol |
| SMILES | Oc1ccccc1C1=NN(c2ccccc2)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C21H18N2O/c24-21-14-8-7-13-18(21)19-15-20(16-9-3-1-4-10-16)23(22-19)17-11-5-2-6-12-17/h1-14,20,24H,15H2/t20-/m1/s1 |
| InChIKey | SGFFIDOKYSINHW-HXUWFJFHSA-N |
| XLogP | 4.75 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|