C16H16N2 — CID 684236
(3R)-5-methyl-2,3-diphenyl-3,4-dihydropyrazole (PubChem CID 684236) has the molecular formula C16H16N2 and a molecular weight of 236.32 g/mol. Its IUPAC name is (3R)-5-methyl-2,3-diphenyl-3,4-dihydropyrazole.
| Compound Name | (3R)-5-methyl-2,3-diphenyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 684236 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (3R)-5-methyl-2,3-diphenyl-3,4-dihydropyrazole |
| SMILES | CC1=NN(c2ccccc2)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C16H16N2/c1-13-12-16(14-8-4-2-5-9-14)18(17-13)15-10-6-3-7-11-15/h2-11,16H,12H2,1H3/t16-/m1/s1 |
| InChIKey | FZTOIOYDPXSQDM-MRXNPFEDSA-N |
| XLogP | 4.01 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |