C16H14Cl2N2 — CID 135029399
2,3-bis(4-chlorophenyl)-5-methyl-3,4-dihydropyrazole (PubChem CID 135029399) has the molecular formula C16H14Cl2N2 and a molecular weight of 305.21 g/mol. Its IUPAC name is 2,3-bis(4-chlorophenyl)-5-methyl-3,4-dihydropyrazole.
| Compound Name | 2,3-bis(4-chlorophenyl)-5-methyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 135029399 |
| Molecular Formula | C16H14Cl2N2 |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2,3-bis(4-chlorophenyl)-5-methyl-3,4-dihydropyrazole |
| SMILES | CC1=NN(c2ccc(Cl)cc2)C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H14Cl2N2/c1-11-10-16(12-2-4-13(17)5-3-12)20(19-11)15-8-6-14(18)7-9-15/h2-9,16H,10H2,1H3 |
| InChIKey | GUKVWKFYRBJHRH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |