C21H15Br2ClN2 — CID 3142862
2,3-bis(4-bromophenyl)-5-(4-chlorophenyl)-3,4-dihydropyrazole (PubChem CID 3142862) has the molecular formula C21H15Br2ClN2 and a molecular weight of 490.63 g/mol. Its IUPAC name is 2,3-bis(4-bromophenyl)-5-(4-chlorophenyl)-3,4-dihydropyrazole.
| Compound Name | 2,3-bis(4-bromophenyl)-5-(4-chlorophenyl)-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 3142862 |
| Molecular Formula | C21H15Br2ClN2 |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 487.93 |
| IUPAC Name | 2,3-bis(4-bromophenyl)-5-(4-chlorophenyl)-3,4-dihydropyrazole |
| SMILES | Clc1ccc(C2=NN(c3ccc(Br)cc3)C(c3ccc(Br)cc3)C2)cc1 |
| InChI | InChI=1S/C21H15Br2ClN2/c22-16-5-1-15(2-6-16)21-13-20(14-3-9-18(24)10-4-14)25-26(21)19-11-7-17(23)8-12-19/h1-12,21H,13H2 |
| InChIKey | NIVJQHBEZLAEAY-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |