C21H16BrClN2O — CID 136732265
2-[3-(4-bromophenyl)-2-(4-chlorophenyl)-3,4-dihydropyrazol-5-yl]phenol (PubChem CID 136732265) has the molecular formula C21H16BrClN2O and a molecular weight of 427.73 g/mol. Its IUPAC name is 2-[3-(4-bromophenyl)-2-(4-chlorophenyl)-3,4-dihydropyrazol-5-yl]phenol.
| Compound Name | 2-[3-(4-bromophenyl)-2-(4-chlorophenyl)-3,4-dihydropyrazol-5-yl]phenol |
|---|---|
| PubChem CID | 136732265 |
| Molecular Formula | C21H16BrClN2O |
| Molecular Weight | 427.73 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | 2-[3-(4-bromophenyl)-2-(4-chlorophenyl)-3,4-dihydropyrazol-5-yl]phenol |
| SMILES | Oc1ccccc1C1=NN(c2ccc(Cl)cc2)C(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C21H16BrClN2O/c22-15-7-5-14(6-8-15)20-13-19(18-3-1-2-4-21(18)26)24-25(20)17-11-9-16(23)10-12-17/h1-12,20,26H,13H2 |
| InChIKey | UXSCQLFXEJRMTL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.73 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|