C22H18Cl2N2O — CID 46502755
3,5-bis(4-chlorophenyl)-2-(4-methoxyphenyl)-3,4-dihydropyrazole (PubChem CID 46502755) has the molecular formula C22H18Cl2N2O and a molecular weight of 397.31 g/mol. Its IUPAC name is 3,5-bis(4-chlorophenyl)-2-(4-methoxyphenyl)-3,4-dihydropyrazole.
| Compound Name | 3,5-bis(4-chlorophenyl)-2-(4-methoxyphenyl)-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 46502755 |
| Molecular Formula | C22H18Cl2N2O |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 3,5-bis(4-chlorophenyl)-2-(4-methoxyphenyl)-3,4-dihydropyrazole |
| SMILES | COc1ccc(N2N=C(c3ccc(Cl)cc3)CC2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H18Cl2N2O/c1-27-20-12-10-19(11-13-20)26-22(16-4-8-18(24)9-5-16)14-21(25-26)15-2-6-17(23)7-3-15/h2-13,22H,14H2,1H3 |
| InChIKey | LLJVOKSVTINLIT-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |