C23H20Cl2N2O2 — CID 26723226
(3S)-2-(3,4-dichlorophenyl)-3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazole (PubChem CID 26723226) has the molecular formula C23H20Cl2N2O2 and a molecular weight of 427.33 g/mol. Its IUPAC name is (3S)-2-(3,4-dichlorophenyl)-3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazole.
| Compound Name | (3S)-2-(3,4-dichlorophenyl)-3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 26723226 |
| Molecular Formula | C23H20Cl2N2O2 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | (3S)-2-(3,4-dichlorophenyl)-3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazole |
| SMILES | COc1ccc(C2=NN(c3ccc(Cl)c(Cl)c3)[C@H](c3ccc(OC)cc3)C2)cc1 |
| InChI | InChI=1S/C23H20Cl2N2O2/c1-28-18-8-3-15(4-9-18)22-14-23(16-5-10-19(29-2)11-6-16)27(26-22)17-7-12-20(24)21(25)13-17/h3-13,23H,14H2,1-2H3/t23-/m0/s1 |
| InChIKey | XFZZZWVPJYLRSW-QHCPKHFHSA-N |
| XLogP | 6.37 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |