C24H22N2O4 — CID 70518687
4-[2,3-bis(4-methoxyphenyl)-3,4-dihydropyrazol-5-yl]benzoic acid (PubChem CID 70518687) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is 4-[2,3-bis(4-methoxyphenyl)-3,4-dihydropyrazol-5-yl]benzoic acid.
| Compound Name | 4-[2,3-bis(4-methoxyphenyl)-3,4-dihydropyrazol-5-yl]benzoic acid |
|---|---|
| PubChem CID | 70518687 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 4-[2,3-bis(4-methoxyphenyl)-3,4-dihydropyrazol-5-yl]benzoic acid |
| SMILES | COc1ccc(C2CC(c3ccc(C(=O)O)cc3)=NN2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H22N2O4/c1-29-20-11-7-17(8-12-20)23-15-22(16-3-5-18(6-4-16)24(27)28)25-26(23)19-9-13-21(30-2)14-10-19/h3-14,23H,15H2,1-2H3,(H,27,28) |
| InChIKey | HPRLEBFBTXYTIM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |